C20H23ClN2O4 — CID 113080567
1-[4-(4-chloro-2,5-dimethoxyphenyl)piperazin-1-yl]-2-phenoxyethanone (PubChem CID 113080567) has the molecular formula C20H23ClN2O4 and a molecular weight of 390.87 g/mol. Its IUPAC name is 1-[4-(4-chloro-2,5-dimethoxyphenyl)piperazin-1-yl]-2-phenoxyethanone.
| Compound Name | 1-[4-(4-chloro-2,5-dimethoxyphenyl)piperazin-1-yl]-2-phenoxyethanone |
|---|---|
| PubChem CID | 113080567 |
| Molecular Formula | C20H23ClN2O4 |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 1-[4-(4-chloro-2,5-dimethoxyphenyl)piperazin-1-yl]-2-phenoxyethanone |
| SMILES | COc1cc(N2CCN(C(=O)COc3ccccc3)CC2)c(OC)cc1Cl |
| InChI | InChI=1S/C20H23ClN2O4/c1-25-18-13-17(19(26-2)12-16(18)21)22-8-10-23(11-9-22)20(24)14-27-15-6-4-3-5-7-15/h3-7,12-13H,8-11,14H2,1-2H3 |
| InChIKey | XJAWACLNJZVLRD-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |