C15H19N2O5- — CID 7317127
2-[2-[4-(2-methoxyphenyl)piperazin-1-yl]-2-oxoethoxy]acetate (PubChem CID 7317127) has the molecular formula C15H19N2O5- and a molecular weight of 307.33 g/mol. Its IUPAC name is 2-[2-[4-(2-methoxyphenyl)piperazin-1-yl]-2-oxoethoxy]acetate.
| Compound Name | 2-[2-[4-(2-methoxyphenyl)piperazin-1-yl]-2-oxoethoxy]acetate |
|---|---|
| PubChem CID | 7317127 |
| Molecular Formula | C15H19N2O5- |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 2-[2-[4-(2-methoxyphenyl)piperazin-1-yl]-2-oxoethoxy]acetate |
| SMILES | COc1ccccc1N1CCN(C(=O)COCC(=O)[O-])CC1 |
| InChI | InChI=1S/C15H20N2O5/c1-21-13-5-3-2-4-12(13)16-6-8-17(9-7-16)14(18)10-22-11-15(19)20/h2-5H,6-11H2,1H3,(H,19,20)/p-1 |
| InChIKey | QQGCLJILXPRUFJ-UHFFFAOYSA-M |
| XLogP | -0.89 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |