C20H22Cl2N3O2+ — CID 2106254
N-[2-(4-benzylpiperazin-4-ium-1-yl)-2-oxoethyl]-3,4-dichlorobenzamide (PubChem CID 2106254) has the molecular formula C20H22Cl2N3O2+ and a molecular weight of 407.32 g/mol. Its IUPAC name is N-[2-(4-benzylpiperazin-4-ium-1-yl)-2-oxoethyl]-3,4-dichlorobenzamide.
| Compound Name | N-[2-(4-benzylpiperazin-4-ium-1-yl)-2-oxoethyl]-3,4-dichlorobenzamide |
|---|---|
| PubChem CID | 2106254 |
| Molecular Formula | C20H22Cl2N3O2+ |
| Molecular Weight | 407.32 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | N-[2-(4-benzylpiperazin-4-ium-1-yl)-2-oxoethyl]-3,4-dichlorobenzamide |
| SMILES | O=C(NCC(=O)N1CC[NH+](Cc2ccccc2)CC1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H21Cl2N3O2/c21-17-7-6-16(12-18(17)22)20(27)23-13-19(26)25-10-8-24(9-11-25)14-15-4-2-1-3-5-15/h1-7,12H,8-11,13-14H2,(H,23,27)/p+1 |
| InChIKey | QMWQWLAYDATQJR-UHFFFAOYSA-O |
| XLogP | 1.65 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.32 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |