C20H23BrN3O2+ — CID 2420335
N-[2-(4-benzylpiperazin-4-ium-1-yl)-2-oxoethyl]-4-bromobenzamide (PubChem CID 2420335) has the molecular formula C20H23BrN3O2+ and a molecular weight of 417.33 g/mol. Its IUPAC name is N-[2-(4-benzylpiperazin-4-ium-1-yl)-2-oxoethyl]-4-bromobenzamide.
| Compound Name | N-[2-(4-benzylpiperazin-4-ium-1-yl)-2-oxoethyl]-4-bromobenzamide |
|---|---|
| PubChem CID | 2420335 |
| Molecular Formula | C20H23BrN3O2+ |
| Molecular Weight | 417.33 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | N-[2-(4-benzylpiperazin-4-ium-1-yl)-2-oxoethyl]-4-bromobenzamide |
| SMILES | O=C(NCC(=O)N1CC[NH+](Cc2ccccc2)CC1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C20H22BrN3O2/c21-18-8-6-17(7-9-18)20(26)22-14-19(25)24-12-10-23(11-13-24)15-16-4-2-1-3-5-16/h1-9H,10-15H2,(H,22,26)/p+1 |
| InChIKey | RAAFELSZSLIDRZ-UHFFFAOYSA-O |
| XLogP | 1.11 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.33 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |