C26H31N3O+2 — CID 7410516
N-benzyl-4-[(4-benzylpiperazine-1,4-diium-1-yl)methyl]benzamide (PubChem CID 7410516) has the molecular formula C26H31N3O+2 and a molecular weight of 401.55 g/mol. Its IUPAC name is N-benzyl-4-[(4-benzylpiperazine-1,4-diium-1-yl)methyl]benzamide.
| Compound Name | N-benzyl-4-[(4-benzylpiperazine-1,4-diium-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 7410516 |
| Molecular Formula | C26H31N3O+2 |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.25 |
| IUPAC Name | N-benzyl-4-[(4-benzylpiperazine-1,4-diium-1-yl)methyl]benzamide |
| SMILES | O=C(NCc1ccccc1)c1ccc(C[NH+]2CC[NH+](Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C26H29N3O/c30-26(27-19-22-7-3-1-4-8-22)25-13-11-24(12-14-25)21-29-17-15-28(16-18-29)20-23-9-5-2-6-10-23/h1-14H,15-21H2,(H,27,30)/p+2 |
| InChIKey | WEOVYVNCGHDMAS-UHFFFAOYSA-P |
| XLogP | 1.10 |
| TPSA | 37.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |