C20H27N3O+2 — CID 8902621
N-benzyl-2-(4-benzylpiperazine-1,4-diium-1-yl)acetamide (PubChem CID 8902621) has the molecular formula C20H27N3O+2 and a molecular weight of 325.46 g/mol. Its IUPAC name is N-benzyl-2-(4-benzylpiperazine-1,4-diium-1-yl)acetamide.
| Compound Name | N-benzyl-2-(4-benzylpiperazine-1,4-diium-1-yl)acetamide |
|---|---|
| PubChem CID | 8902621 |
| Molecular Formula | C20H27N3O+2 |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.21 |
| IUPAC Name | N-benzyl-2-(4-benzylpiperazine-1,4-diium-1-yl)acetamide |
| SMILES | O=C(C[NH+]1CC[NH+](Cc2ccccc2)CC1)NCc1ccccc1 |
| InChI | InChI=1S/C20H25N3O/c24-20(21-15-18-7-3-1-4-8-18)17-23-13-11-22(12-14-23)16-19-9-5-2-6-10-19/h1-10H,11-17H2,(H,21,24)/p+2 |
| InChIKey | MZXQDYFQFXGLHT-UHFFFAOYSA-P |
| XLogP | -0.71 |
| TPSA | 37.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |