C19H23F2N3O+2 — CID 8902726
2-(4-benzylpiperazine-1,4-diium-1-yl)-N-(2,5-difluorophenyl)acetamide (PubChem CID 8902726) has the molecular formula C19H23F2N3O+2 and a molecular weight of 347.41 g/mol. Its IUPAC name is 2-(4-benzylpiperazine-1,4-diium-1-yl)-N-(2,5-difluorophenyl)acetamide.
| Compound Name | 2-(4-benzylpiperazine-1,4-diium-1-yl)-N-(2,5-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 8902726 |
| Molecular Formula | C19H23F2N3O+2 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | 2-(4-benzylpiperazine-1,4-diium-1-yl)-N-(2,5-difluorophenyl)acetamide |
| SMILES | O=C(C[NH+]1CC[NH+](Cc2ccccc2)CC1)Nc1cc(F)ccc1F |
| InChI | InChI=1S/C19H21F2N3O/c20-16-6-7-17(21)18(12-16)22-19(25)14-24-10-8-23(9-11-24)13-15-4-2-1-3-5-15/h1-7,12H,8-11,13-14H2,(H,22,25)/p+2 |
| InChIKey | WXYVHRDYPBBWTG-UHFFFAOYSA-P |
| XLogP | -0.11 |
| TPSA | 37.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |