C19H24FN3O+2 — CID 5155461
2-(4-benzylpiperazine-1,4-diium-1-yl)-N-(4-fluorophenyl)acetamide (PubChem CID 5155461) has the molecular formula C19H24FN3O+2 and a molecular weight of 329.42 g/mol. Its IUPAC name is 2-(4-benzylpiperazine-1,4-diium-1-yl)-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-(4-benzylpiperazine-1,4-diium-1-yl)-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 5155461 |
| Molecular Formula | C19H24FN3O+2 |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | 2-(4-benzylpiperazine-1,4-diium-1-yl)-N-(4-fluorophenyl)acetamide |
| SMILES | O=C(C[NH+]1CC[NH+](Cc2ccccc2)CC1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C19H22FN3O/c20-17-6-8-18(9-7-17)21-19(24)15-23-12-10-22(11-13-23)14-16-4-2-1-3-5-16/h1-9H,10-15H2,(H,21,24)/p+2 |
| InChIKey | WQBBOZDPFPVNCM-UHFFFAOYSA-P |
| XLogP | -0.25 |
| TPSA | 37.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |