C20H26N4O2+2 — CID 4296629
4-[[2-(4-benzylpiperazine-1,4-diium-1-yl)acetyl]amino]benzamide (PubChem CID 4296629) has the molecular formula C20H26N4O2+2 and a molecular weight of 354.45 g/mol. Its IUPAC name is 4-[[2-(4-benzylpiperazine-1,4-diium-1-yl)acetyl]amino]benzamide.
| Compound Name | 4-[[2-(4-benzylpiperazine-1,4-diium-1-yl)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 4296629 |
| Molecular Formula | C20H26N4O2+2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | 4-[[2-(4-benzylpiperazine-1,4-diium-1-yl)acetyl]amino]benzamide |
| SMILES | NC(=O)c1ccc(NC(=O)C[NH+]2CC[NH+](Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C20H24N4O2/c21-20(26)17-6-8-18(9-7-17)22-19(25)15-24-12-10-23(11-13-24)14-16-4-2-1-3-5-16/h1-9H,10-15H2,(H2,21,26)(H,22,25)/p+2 |
| InChIKey | NDAVEJBRWDBPEO-UHFFFAOYSA-P |
| XLogP | -1.29 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |