C23H27N3O+2 — CID 2697461
2-(4-benzylpiperazine-1,4-diium-1-yl)-N-naphthalen-2-ylacetamide (PubChem CID 2697461) has the molecular formula C23H27N3O+2 and a molecular weight of 361.49 g/mol. Its IUPAC name is 2-(4-benzylpiperazine-1,4-diium-1-yl)-N-naphthalen-2-ylacetamide.
| Compound Name | 2-(4-benzylpiperazine-1,4-diium-1-yl)-N-naphthalen-2-ylacetamide |
|---|---|
| PubChem CID | 2697461 |
| Molecular Formula | C23H27N3O+2 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.21 |
| IUPAC Name | 2-(4-benzylpiperazine-1,4-diium-1-yl)-N-naphthalen-2-ylacetamide |
| SMILES | O=C(C[NH+]1CC[NH+](Cc2ccccc2)CC1)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C23H25N3O/c27-23(24-22-11-10-20-8-4-5-9-21(20)16-22)18-26-14-12-25(13-15-26)17-19-6-2-1-3-7-19/h1-11,16H,12-15,17-18H2,(H,24,27)/p+2 |
| InChIKey | DZTFNFPSJXIZHE-UHFFFAOYSA-P |
| XLogP | 0.76 |
| TPSA | 37.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |