C23H26N3O2+ — CID 2483117
2-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]-N-naphthalen-2-ylacetamide (PubChem CID 2483117) has the molecular formula C23H26N3O2+ and a molecular weight of 376.48 g/mol. Its IUPAC name is 2-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]-N-naphthalen-2-ylacetamide.
| Compound Name | 2-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]-N-naphthalen-2-ylacetamide |
|---|---|
| PubChem CID | 2483117 |
| Molecular Formula | C23H26N3O2+ |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 2-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]-N-naphthalen-2-ylacetamide |
| SMILES | COc1ccc(N2CC[NH+](CC(=O)Nc3ccc4ccccc4c3)CC2)cc1 |
| InChI | InChI=1S/C23H25N3O2/c1-28-22-10-8-21(9-11-22)26-14-12-25(13-15-26)17-23(27)24-20-7-6-18-4-2-3-5-19(18)16-20/h2-11,16H,12-15,17H2,1H3,(H,24,27)/p+1 |
| InChIKey | QCQQALQWFCJSRW-UHFFFAOYSA-O |
| XLogP | 2.19 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|