C21H27ClN3O2+ — CID 8587029
N-(2-chloro-4,6-dimethylphenyl)-2-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]acetamide (PubChem CID 8587029) has the molecular formula C21H27ClN3O2+ and a molecular weight of 388.92 g/mol. Its IUPAC name is N-(2-chloro-4,6-dimethylphenyl)-2-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]acetamide.
| Compound Name | N-(2-chloro-4,6-dimethylphenyl)-2-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 8587029 |
| Molecular Formula | C21H27ClN3O2+ |
| Molecular Weight | 388.92 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | N-(2-chloro-4,6-dimethylphenyl)-2-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]acetamide |
| SMILES | COc1ccc(N2CC[NH+](CC(=O)Nc3c(C)cc(C)cc3Cl)CC2)cc1 |
| InChI | InChI=1S/C21H26ClN3O2/c1-15-12-16(2)21(19(22)13-15)23-20(26)14-24-8-10-25(11-9-24)17-4-6-18(27-3)7-5-17/h4-7,12-13H,8-11,14H2,1-3H3,(H,23,26)/p+1 |
| InChIKey | OZNURYPJLGKZAQ-UHFFFAOYSA-O |
| XLogP | 2.31 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.92 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|