C21H26Cl2N3O2+ — CID 8587776
N-[2-(2,4-dichlorophenyl)ethyl]-2-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]acetamide (PubChem CID 8587776) has the molecular formula C21H26Cl2N3O2+ and a molecular weight of 423.36 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenyl)ethyl]-2-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]acetamide.
| Compound Name | N-[2-(2,4-dichlorophenyl)ethyl]-2-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 8587776 |
| Molecular Formula | C21H26Cl2N3O2+ |
| Molecular Weight | 423.36 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | N-[2-(2,4-dichlorophenyl)ethyl]-2-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]acetamide |
| SMILES | COc1ccc(N2CC[NH+](CC(=O)NCCc3ccc(Cl)cc3Cl)CC2)cc1 |
| InChI | InChI=1S/C21H25Cl2N3O2/c1-28-19-6-4-18(5-7-19)26-12-10-25(11-13-26)15-21(27)24-9-8-16-2-3-17(22)14-20(16)23/h2-7,14H,8-13,15H2,1H3,(H,24,27)/p+1 |
| InChIKey | VKHDBVRPMRFHNI-UHFFFAOYSA-O |
| XLogP | 2.07 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.36 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|