C20H24Cl2N3O+ — CID 8530398
N-[2-(4-chlorophenyl)ethyl]-2-[4-(3-chlorophenyl)piperazin-1-ium-1-yl]acetamide (PubChem CID 8530398) has the molecular formula C20H24Cl2N3O+ and a molecular weight of 393.34 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)ethyl]-2-[4-(3-chlorophenyl)piperazin-1-ium-1-yl]acetamide.
| Compound Name | N-[2-(4-chlorophenyl)ethyl]-2-[4-(3-chlorophenyl)piperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 8530398 |
| Molecular Formula | C20H24Cl2N3O+ |
| Molecular Weight | 393.34 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | N-[2-(4-chlorophenyl)ethyl]-2-[4-(3-chlorophenyl)piperazin-1-ium-1-yl]acetamide |
| SMILES | O=C(C[NH+]1CCN(c2cccc(Cl)c2)CC1)NCCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H23Cl2N3O/c21-17-6-4-16(5-7-17)8-9-23-20(26)15-24-10-12-25(13-11-24)19-3-1-2-18(22)14-19/h1-7,14H,8-13,15H2,(H,23,26)/p+1 |
| InChIKey | PLUYHLAVJNQMAM-UHFFFAOYSA-O |
| XLogP | 2.06 |
| TPSA | 36.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.34 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |