C24H25ClN3O2+ — CID 6958022
2-[4-(3-chlorophenyl)piperazin-1-ium-1-yl]-N-(4-phenoxyphenyl)acetamide (PubChem CID 6958022) has the molecular formula C24H25ClN3O2+ and a molecular weight of 422.94 g/mol. Its IUPAC name is 2-[4-(3-chlorophenyl)piperazin-1-ium-1-yl]-N-(4-phenoxyphenyl)acetamide.
| Compound Name | 2-[4-(3-chlorophenyl)piperazin-1-ium-1-yl]-N-(4-phenoxyphenyl)acetamide |
|---|---|
| PubChem CID | 6958022 |
| Molecular Formula | C24H25ClN3O2+ |
| Molecular Weight | 422.94 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | 2-[4-(3-chlorophenyl)piperazin-1-ium-1-yl]-N-(4-phenoxyphenyl)acetamide |
| SMILES | O=C(C[NH+]1CCN(c2cccc(Cl)c2)CC1)Nc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C24H24ClN3O2/c25-19-5-4-6-21(17-19)28-15-13-27(14-16-28)18-24(29)26-20-9-11-23(12-10-20)30-22-7-2-1-3-8-22/h1-12,17H,13-16,18H2,(H,26,29)/p+1 |
| InChIKey | HQODTXWUVKNYSF-UHFFFAOYSA-O |
| XLogP | 3.48 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.94 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |