C19H22ClFN3O2+ — CID 8592500
N-(4-chloro-2-fluorophenyl)-2-[4-(3-methoxyphenyl)piperazin-1-ium-1-yl]acetamide (PubChem CID 8592500) has the molecular formula C19H22ClFN3O2+ and a molecular weight of 378.86 g/mol. Its IUPAC name is N-(4-chloro-2-fluorophenyl)-2-[4-(3-methoxyphenyl)piperazin-1-ium-1-yl]acetamide.
| Compound Name | N-(4-chloro-2-fluorophenyl)-2-[4-(3-methoxyphenyl)piperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 8592500 |
| Molecular Formula | C19H22ClFN3O2+ |
| Molecular Weight | 378.86 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | N-(4-chloro-2-fluorophenyl)-2-[4-(3-methoxyphenyl)piperazin-1-ium-1-yl]acetamide |
| SMILES | COc1cccc(N2CC[NH+](CC(=O)Nc3ccc(Cl)cc3F)CC2)c1 |
| InChI | InChI=1S/C19H21ClFN3O2/c1-26-16-4-2-3-15(12-16)24-9-7-23(8-10-24)13-19(25)22-18-6-5-14(20)11-17(18)21/h2-6,11-12H,7-10,13H2,1H3,(H,22,25)/p+1 |
| InChIKey | YGGLAVBKVKPYNS-UHFFFAOYSA-O |
| XLogP | 1.83 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.86 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |