C19H22Cl2N3O2+ — CID 2698435
N-(2,6-dichlorophenyl)-2-[4-(3-methoxyphenyl)piperazin-1-ium-1-yl]acetamide (PubChem CID 2698435) has the molecular formula C19H22Cl2N3O2+ and a molecular weight of 395.31 g/mol. Its IUPAC name is N-(2,6-dichlorophenyl)-2-[4-(3-methoxyphenyl)piperazin-1-ium-1-yl]acetamide.
| Compound Name | N-(2,6-dichlorophenyl)-2-[4-(3-methoxyphenyl)piperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 2698435 |
| Molecular Formula | C19H22Cl2N3O2+ |
| Molecular Weight | 395.31 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | N-(2,6-dichlorophenyl)-2-[4-(3-methoxyphenyl)piperazin-1-ium-1-yl]acetamide |
| SMILES | COc1cccc(N2CC[NH+](CC(=O)Nc3c(Cl)cccc3Cl)CC2)c1 |
| InChI | InChI=1S/C19H21Cl2N3O2/c1-26-15-5-2-4-14(12-15)24-10-8-23(9-11-24)13-18(25)22-19-16(20)6-3-7-17(19)21/h2-7,12H,8-11,13H2,1H3,(H,22,25)/p+1 |
| InChIKey | LBIYWFASNNUMPR-UHFFFAOYSA-O |
| XLogP | 2.35 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.31 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |