C20H25N4O3+ — CID 8592125
N'-[2-[4-(3-methoxyphenyl)piperazin-1-ium-1-yl]acetyl]benzohydrazide (PubChem CID 8592125) has the molecular formula C20H25N4O3+ and a molecular weight of 369.45 g/mol. Its IUPAC name is N'-[2-[4-(3-methoxyphenyl)piperazin-1-ium-1-yl]acetyl]benzohydrazide.
| Compound Name | N'-[2-[4-(3-methoxyphenyl)piperazin-1-ium-1-yl]acetyl]benzohydrazide |
|---|---|
| PubChem CID | 8592125 |
| Molecular Formula | C20H25N4O3+ |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | N'-[2-[4-(3-methoxyphenyl)piperazin-1-ium-1-yl]acetyl]benzohydrazide |
| SMILES | COc1cccc(N2CC[NH+](CC(=O)NNC(=O)c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C20H24N4O3/c1-27-18-9-5-8-17(14-18)24-12-10-23(11-13-24)15-19(25)21-22-20(26)16-6-3-2-4-7-16/h2-9,14H,10-13,15H2,1H3,(H,21,25)(H,22,26)/p+1 |
| InChIKey | YFYYPGGPNUSEKZ-UHFFFAOYSA-O |
| XLogP | -0.14 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|