C21H27N4O2+ — CID 7891809
3-methyl-N'-[3-(4-phenylpiperazin-1-ium-1-yl)propanoyl]benzohydrazide (PubChem CID 7891809) has the molecular formula C21H27N4O2+ and a molecular weight of 367.47 g/mol. Its IUPAC name is 3-methyl-N'-[3-(4-phenylpiperazin-1-ium-1-yl)propanoyl]benzohydrazide.
| Compound Name | 3-methyl-N'-[3-(4-phenylpiperazin-1-ium-1-yl)propanoyl]benzohydrazide |
|---|---|
| PubChem CID | 7891809 |
| Molecular Formula | C21H27N4O2+ |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | 3-methyl-N'-[3-(4-phenylpiperazin-1-ium-1-yl)propanoyl]benzohydrazide |
| SMILES | Cc1cccc(C(=O)NNC(=O)CC[NH+]2CCN(c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C21H26N4O2/c1-17-6-5-7-18(16-17)21(27)23-22-20(26)10-11-24-12-14-25(15-13-24)19-8-3-2-4-9-19/h2-9,16H,10-15H2,1H3,(H,22,26)(H,23,27)/p+1 |
| InChIKey | QUTPLKONDVZQIO-UHFFFAOYSA-O |
| XLogP | 0.55 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|