C20H26N3O+ — CID 4995663
3-methyl-N-[2-(4-phenylpiperazin-1-ium-1-yl)ethyl]benzamide (PubChem CID 4995663) has the molecular formula C20H26N3O+ and a molecular weight of 324.45 g/mol. Its IUPAC name is 3-methyl-N-[2-(4-phenylpiperazin-1-ium-1-yl)ethyl]benzamide.
| Compound Name | 3-methyl-N-[2-(4-phenylpiperazin-1-ium-1-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 4995663 |
| Molecular Formula | C20H26N3O+ |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.21 |
| IUPAC Name | 3-methyl-N-[2-(4-phenylpiperazin-1-ium-1-yl)ethyl]benzamide |
| SMILES | Cc1cccc(C(=O)NCC[NH+]2CCN(c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C20H25N3O/c1-17-6-5-7-18(16-17)20(24)21-10-11-22-12-14-23(15-13-22)19-8-3-2-4-9-19/h2-9,16H,10-15H2,1H3,(H,21,24)/p+1 |
| InChIKey | BVNVSFIWPXOPDU-UHFFFAOYSA-O |
| XLogP | 1.13 |
| TPSA | 36.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |