C23H31N3O — CID 55860989
3,5-dimethyl-N-[4-(4-phenylpiperazin-1-yl)butyl]benzamide (PubChem CID 55860989) has the molecular formula C23H31N3O and a molecular weight of 365.52 g/mol. Its IUPAC name is 3,5-dimethyl-N-[4-(4-phenylpiperazin-1-yl)butyl]benzamide.
| Compound Name | 3,5-dimethyl-N-[4-(4-phenylpiperazin-1-yl)butyl]benzamide |
|---|---|
| PubChem CID | 55860989 |
| Molecular Formula | C23H31N3O |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.25 |
| IUPAC Name | 3,5-dimethyl-N-[4-(4-phenylpiperazin-1-yl)butyl]benzamide |
| SMILES | Cc1cc(C)cc(C(=O)NCCCCN2CCN(c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C23H31N3O/c1-19-16-20(2)18-21(17-19)23(27)24-10-6-7-11-25-12-14-26(15-13-25)22-8-4-3-5-9-22/h3-5,8-9,16-18H,6-7,10-15H2,1-2H3,(H,24,27) |
| InChIKey | OASHUIKSGLSHGB-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|