C26H37N3O4 — CID 42224516
3,4,5-triethoxy-N-[3-(4-phenylpiperazin-1-yl)propyl]benzamide (PubChem CID 42224516) has the molecular formula C26H37N3O4 and a molecular weight of 455.60 g/mol. Its IUPAC name is 3,4,5-triethoxy-N-[3-(4-phenylpiperazin-1-yl)propyl]benzamide.
| Compound Name | 3,4,5-triethoxy-N-[3-(4-phenylpiperazin-1-yl)propyl]benzamide |
|---|---|
| PubChem CID | 42224516 |
| Molecular Formula | C26H37N3O4 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.28 |
| IUPAC Name | 3,4,5-triethoxy-N-[3-(4-phenylpiperazin-1-yl)propyl]benzamide |
| SMILES | CCOc1cc(C(=O)NCCCN2CCN(c3ccccc3)CC2)cc(OCC)c1OCC |
| InChI | InChI=1S/C26H37N3O4/c1-4-31-23-19-21(20-24(32-5-2)25(23)33-6-3)26(30)27-13-10-14-28-15-17-29(18-16-28)22-11-8-7-9-12-22/h7-9,11-12,19-20H,4-6,10,13-18H2,1-3H3,(H,27,30) |
| InChIKey | NTZPFIMPKWWMCR-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|