C28H40N4O4 — CID 2932757
2-ethoxy-N-[3-[4-[3-[(2-ethoxybenzoyl)amino]propyl]piperazin-1-yl]propyl]benzamide (PubChem CID 2932757) has the molecular formula C28H40N4O4 and a molecular weight of 496.65 g/mol. Its IUPAC name is 2-ethoxy-N-[3-[4-[3-[(2-ethoxybenzoyl)amino]propyl]piperazin-1-yl]propyl]benzamide.
| Compound Name | 2-ethoxy-N-[3-[4-[3-[(2-ethoxybenzoyl)amino]propyl]piperazin-1-yl]propyl]benzamide |
|---|---|
| PubChem CID | 2932757 |
| Molecular Formula | C28H40N4O4 |
| Molecular Weight | 496.65 g/mol |
| Exact Mass | 496.30 |
| IUPAC Name | 2-ethoxy-N-[3-[4-[3-[(2-ethoxybenzoyl)amino]propyl]piperazin-1-yl]propyl]benzamide |
| SMILES | CCOc1ccccc1C(=O)NCCCN1CCN(CCCNC(=O)c2ccccc2OCC)CC1 |
| InChI | InChI=1S/C28H40N4O4/c1-3-35-25-13-7-5-11-23(25)27(33)29-15-9-17-31-19-21-32(22-20-31)18-10-16-30-28(34)24-12-6-8-14-26(24)36-4-2/h5-8,11-14H,3-4,9-10,15-22H2,1-2H3,(H,29,33)(H,30,34) |
| InChIKey | IPBCKQQJVHVTAO-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.65 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|