C14H17NO2 — CID 103709030
2-ethoxy-N-pent-4-ynylbenzamide (PubChem CID 103709030) has the molecular formula C14H17NO2 and a molecular weight of 231.30 g/mol. Its IUPAC name is 2-ethoxy-N-pent-4-ynylbenzamide.
| Compound Name | 2-ethoxy-N-pent-4-ynylbenzamide |
|---|---|
| PubChem CID | 103709030 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | 2-ethoxy-N-pent-4-ynylbenzamide |
| SMILES | C#CCCCNC(=O)c1ccccc1OCC |
| InChI | InChI=1S/C14H17NO2/c1-3-5-8-11-15-14(16)12-9-6-7-10-13(12)17-4-2/h1,6-7,9-10H,4-5,8,11H2,2H3,(H,15,16) |
| InChIKey | GEVPBRWUQTWFQT-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|