C25H35N3O4 — CID 42266222
3,4,5-triethoxy-N-[2-(4-phenylpiperazin-1-yl)ethyl]benzamide (PubChem CID 42266222) has the molecular formula C25H35N3O4 and a molecular weight of 441.57 g/mol. Its IUPAC name is 3,4,5-triethoxy-N-[2-(4-phenylpiperazin-1-yl)ethyl]benzamide.
| Compound Name | 3,4,5-triethoxy-N-[2-(4-phenylpiperazin-1-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 42266222 |
| Molecular Formula | C25H35N3O4 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.26 |
| IUPAC Name | 3,4,5-triethoxy-N-[2-(4-phenylpiperazin-1-yl)ethyl]benzamide |
| SMILES | CCOc1cc(C(=O)NCCN2CCN(c3ccccc3)CC2)cc(OCC)c1OCC |
| InChI | InChI=1S/C25H35N3O4/c1-4-30-22-18-20(19-23(31-5-2)24(22)32-6-3)25(29)26-12-13-27-14-16-28(17-15-27)21-10-8-7-9-11-21/h7-11,18-19H,4-6,12-17H2,1-3H3,(H,26,29) |
| InChIKey | YUVVFGRTDMOKGQ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |