C23H28N4O — CID 46412846
2,3-dimethyl-N-[2-(4-phenylpiperazin-1-yl)ethyl]-1H-indole-5-carboxamide (PubChem CID 46412846) has the molecular formula C23H28N4O and a molecular weight of 376.50 g/mol. Its IUPAC name is 2,3-dimethyl-N-[2-(4-phenylpiperazin-1-yl)ethyl]-1H-indole-5-carboxamide.
| Compound Name | 2,3-dimethyl-N-[2-(4-phenylpiperazin-1-yl)ethyl]-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 46412846 |
| Molecular Formula | C23H28N4O |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | 2,3-dimethyl-N-[2-(4-phenylpiperazin-1-yl)ethyl]-1H-indole-5-carboxamide |
| SMILES | Cc1[nH]c2ccc(C(=O)NCCN3CCN(c4ccccc4)CC3)cc2c1C |
| InChI | InChI=1S/C23H28N4O/c1-17-18(2)25-22-9-8-19(16-21(17)22)23(28)24-10-11-26-12-14-27(15-13-26)20-6-4-3-5-7-20/h3-9,16,25H,10-15H2,1-2H3,(H,24,28) |
| InChIKey | LNVLFPLBZRAWQL-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 51.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|