C23H30N4O5 — CID 55638800
4-ethoxy-5-methoxy-2-nitro-N-[3-(4-phenylpiperazin-1-yl)propyl]benzamide (PubChem CID 55638800) has the molecular formula C23H30N4O5 and a molecular weight of 442.52 g/mol. Its IUPAC name is 4-ethoxy-5-methoxy-2-nitro-N-[3-(4-phenylpiperazin-1-yl)propyl]benzamide.
| Compound Name | 4-ethoxy-5-methoxy-2-nitro-N-[3-(4-phenylpiperazin-1-yl)propyl]benzamide |
|---|---|
| PubChem CID | 55638800 |
| Molecular Formula | C23H30N4O5 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | 4-ethoxy-5-methoxy-2-nitro-N-[3-(4-phenylpiperazin-1-yl)propyl]benzamide |
| SMILES | CCOc1cc([N+](=O)[O-])c(C(=O)NCCCN2CCN(c3ccccc3)CC2)cc1OC |
| InChI | InChI=1S/C23H30N4O5/c1-3-32-22-17-20(27(29)30)19(16-21(22)31-2)23(28)24-10-7-11-25-12-14-26(15-13-25)18-8-5-4-6-9-18/h4-6,8-9,16-17H,3,7,10-15H2,1-2H3,(H,24,28) |
| InChIKey | AZBBBQORWWRAHL-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 97.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|