C19H23N3O7S — CID 55795890
N-[2-(benzylsulfamoyl)ethyl]-5-ethoxy-4-methoxy-2-nitrobenzamide (PubChem CID 55795890) has the molecular formula C19H23N3O7S and a molecular weight of 437.47 g/mol. Its IUPAC name is N-[2-(benzylsulfamoyl)ethyl]-5-ethoxy-4-methoxy-2-nitrobenzamide.
| Compound Name | N-[2-(benzylsulfamoyl)ethyl]-5-ethoxy-4-methoxy-2-nitrobenzamide |
|---|---|
| PubChem CID | 55795890 |
| Molecular Formula | C19H23N3O7S |
| Molecular Weight | 437.47 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | N-[2-(benzylsulfamoyl)ethyl]-5-ethoxy-4-methoxy-2-nitrobenzamide |
| SMILES | CCOc1cc(C(=O)NCCS(=O)(=O)NCc2ccccc2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C19H23N3O7S/c1-3-29-18-11-15(16(22(24)25)12-17(18)28-2)19(23)20-9-10-30(26,27)21-13-14-7-5-4-6-8-14/h4-8,11-12,21H,3,9-10,13H2,1-2H3,(H,20,23) |
| InChIKey | RDNIXEINTGXFID-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 136.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.47 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|