C25H26N2O6 — CID 55749777
4-ethoxy-5-methoxy-2-nitro-N-[2-(4-phenylmethoxyphenyl)ethyl]benzamide (PubChem CID 55749777) has the molecular formula C25H26N2O6 and a molecular weight of 450.49 g/mol. Its IUPAC name is 4-ethoxy-5-methoxy-2-nitro-N-[2-(4-phenylmethoxyphenyl)ethyl]benzamide.
| Compound Name | 4-ethoxy-5-methoxy-2-nitro-N-[2-(4-phenylmethoxyphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 55749777 |
| Molecular Formula | C25H26N2O6 |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | 4-ethoxy-5-methoxy-2-nitro-N-[2-(4-phenylmethoxyphenyl)ethyl]benzamide |
| SMILES | CCOc1cc([N+](=O)[O-])c(C(=O)NCCc2ccc(OCc3ccccc3)cc2)cc1OC |
| InChI | InChI=1S/C25H26N2O6/c1-3-32-24-16-22(27(29)30)21(15-23(24)31-2)25(28)26-14-13-18-9-11-20(12-10-18)33-17-19-7-5-4-6-8-19/h4-12,15-16H,3,13-14,17H2,1-2H3,(H,26,28) |
| InChIKey | WAFOYOUHXSAMBW-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|