C23H31N4O3+ — CID 7550974
(2S)-2-(3-methylphenoxy)-N'-[3-(4-phenylpiperazin-1-ium-1-yl)propanoyl]propanehydrazide (PubChem CID 7550974) has the molecular formula C23H31N4O3+ and a molecular weight of 411.53 g/mol. Its IUPAC name is (2S)-2-(3-methylphenoxy)-N'-[3-(4-phenylpiperazin-1-ium-1-yl)propanoyl]propanehydrazide.
| Compound Name | (2S)-2-(3-methylphenoxy)-N'-[3-(4-phenylpiperazin-1-ium-1-yl)propanoyl]propanehydrazide |
|---|---|
| PubChem CID | 7550974 |
| Molecular Formula | C23H31N4O3+ |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | (2S)-2-(3-methylphenoxy)-N'-[3-(4-phenylpiperazin-1-ium-1-yl)propanoyl]propanehydrazide |
| SMILES | Cc1cccc(O[C@@H](C)C(=O)NNC(=O)CC[NH+]2CCN(c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C23H30N4O3/c1-18-7-6-10-21(17-18)30-19(2)23(29)25-24-22(28)11-12-26-13-15-27(16-14-26)20-8-4-3-5-9-20/h3-10,17,19H,11-16H2,1-2H3,(H,24,28)(H,25,29)/p+1/t19-/m0/s1 |
| InChIKey | XQQPNDIHCQIGRM-IBGZPJMESA-O |
| XLogP | 0.70 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|