C21H26FN4O2+ — CID 7550967
N'-[2-(3-fluorophenyl)acetyl]-3-(4-phenylpiperazin-1-ium-1-yl)propanehydrazide (PubChem CID 7550967) has the molecular formula C21H26FN4O2+ and a molecular weight of 385.46 g/mol. Its IUPAC name is N'-[2-(3-fluorophenyl)acetyl]-3-(4-phenylpiperazin-1-ium-1-yl)propanehydrazide.
| Compound Name | N'-[2-(3-fluorophenyl)acetyl]-3-(4-phenylpiperazin-1-ium-1-yl)propanehydrazide |
|---|---|
| PubChem CID | 7550967 |
| Molecular Formula | C21H26FN4O2+ |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | N'-[2-(3-fluorophenyl)acetyl]-3-(4-phenylpiperazin-1-ium-1-yl)propanehydrazide |
| SMILES | O=C(CC[NH+]1CCN(c2ccccc2)CC1)NNC(=O)Cc1cccc(F)c1 |
| InChI | InChI=1S/C21H25FN4O2/c22-18-6-4-5-17(15-18)16-21(28)24-23-20(27)9-10-25-11-13-26(14-12-25)19-7-2-1-3-8-19/h1-8,15H,9-14,16H2,(H,23,27)(H,24,28)/p+1 |
| InChIKey | LABJFJLQEAYQRT-UHFFFAOYSA-O |
| XLogP | 0.31 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|