C19H26N5O3+ — CID 2649187
3,5-dimethyl-N'-[3-(4-phenylpiperazin-1-ium-1-yl)propanoyl]-1,2-oxazole-4-carbohydrazide (PubChem CID 2649187) has the molecular formula C19H26N5O3+ and a molecular weight of 372.45 g/mol. Its IUPAC name is 3,5-dimethyl-N'-[3-(4-phenylpiperazin-1-ium-1-yl)propanoyl]-1,2-oxazole-4-carbohydrazide.
| Compound Name | 3,5-dimethyl-N'-[3-(4-phenylpiperazin-1-ium-1-yl)propanoyl]-1,2-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 2649187 |
| Molecular Formula | C19H26N5O3+ |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | 3,5-dimethyl-N'-[3-(4-phenylpiperazin-1-ium-1-yl)propanoyl]-1,2-oxazole-4-carbohydrazide |
| SMILES | Cc1noc(C)c1C(=O)NNC(=O)CC[NH+]1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C19H25N5O3/c1-14-18(15(2)27-22-14)19(26)21-20-17(25)8-9-23-10-12-24(13-11-23)16-6-4-3-5-7-16/h3-7H,8-13H2,1-2H3,(H,20,25)(H,21,26)/p+1 |
| InChIKey | JZGIWEGWQBRPLR-UHFFFAOYSA-O |
| XLogP | -0.15 |
| TPSA | 91.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|