C22H30N5O2S+ — CID 8614583
1-(4-ethoxyphenyl)-3-[3-(4-phenylpiperazin-1-ium-1-yl)propanoylamino]thiourea (PubChem CID 8614583) has the molecular formula C22H30N5O2S+ and a molecular weight of 428.58 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)-3-[3-(4-phenylpiperazin-1-ium-1-yl)propanoylamino]thiourea.
| Compound Name | 1-(4-ethoxyphenyl)-3-[3-(4-phenylpiperazin-1-ium-1-yl)propanoylamino]thiourea |
|---|---|
| PubChem CID | 8614583 |
| Molecular Formula | C22H30N5O2S+ |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | 1-(4-ethoxyphenyl)-3-[3-(4-phenylpiperazin-1-ium-1-yl)propanoylamino]thiourea |
| SMILES | CCOc1ccc(NC(=S)NNC(=O)CC[NH+]2CCN(c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C22H29N5O2S/c1-2-29-20-10-8-18(9-11-20)23-22(30)25-24-21(28)12-13-26-14-16-27(17-15-26)19-6-4-3-5-7-19/h3-11H,2,12-17H2,1H3,(H,24,28)(H2,23,25,30)/p+1 |
| InChIKey | CSIXCDMRCHOMIH-UHFFFAOYSA-O |
| XLogP | 1.20 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|