C24H31N4O3+ — CID 9150896
N'-[(E)-3-(4-ethoxyphenyl)prop-2-enoyl]-3-(4-phenylpiperazin-1-ium-1-yl)propanehydrazide (PubChem CID 9150896) has the molecular formula C24H31N4O3+ and a molecular weight of 423.54 g/mol. Its IUPAC name is N'-[(E)-3-(4-ethoxyphenyl)prop-2-enoyl]-3-(4-phenylpiperazin-1-ium-1-yl)propanehydrazide.
| Compound Name | N'-[(E)-3-(4-ethoxyphenyl)prop-2-enoyl]-3-(4-phenylpiperazin-1-ium-1-yl)propanehydrazide |
|---|---|
| PubChem CID | 9150896 |
| Molecular Formula | C24H31N4O3+ |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | N'-[(E)-3-(4-ethoxyphenyl)prop-2-enoyl]-3-(4-phenylpiperazin-1-ium-1-yl)propanehydrazide |
| SMILES | CCOc1ccc(/C=C/C(=O)NNC(=O)CC[NH+]2CCN(c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C24H30N4O3/c1-2-31-22-11-8-20(9-12-22)10-13-23(29)25-26-24(30)14-15-27-16-18-28(19-17-27)21-6-4-3-5-7-21/h3-13H,2,14-19H2,1H3,(H,25,29)(H,26,30)/p+1/b13-10+ |
| InChIKey | ILZWYJNKUFBSGB-JLHYYAGUSA-O |
| XLogP | 1.04 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|