C21H25F2N4O3+ — CID 7891743
4-(difluoromethoxy)-N'-[3-(4-phenylpiperazin-1-ium-1-yl)propanoyl]benzohydrazide (PubChem CID 7891743) has the molecular formula C21H25F2N4O3+ and a molecular weight of 419.45 g/mol. Its IUPAC name is 4-(difluoromethoxy)-N'-[3-(4-phenylpiperazin-1-ium-1-yl)propanoyl]benzohydrazide.
| Compound Name | 4-(difluoromethoxy)-N'-[3-(4-phenylpiperazin-1-ium-1-yl)propanoyl]benzohydrazide |
|---|---|
| PubChem CID | 7891743 |
| Molecular Formula | C21H25F2N4O3+ |
| Molecular Weight | 419.45 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | 4-(difluoromethoxy)-N'-[3-(4-phenylpiperazin-1-ium-1-yl)propanoyl]benzohydrazide |
| SMILES | O=C(CC[NH+]1CCN(c2ccccc2)CC1)NNC(=O)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C21H24F2N4O3/c22-21(23)30-18-8-6-16(7-9-18)20(29)25-24-19(28)10-11-26-12-14-27(15-13-26)17-4-2-1-3-5-17/h1-9,21H,10-15H2,(H,24,28)(H,25,29)/p+1 |
| InChIKey | ZXMYVTBGYIIDBE-UHFFFAOYSA-O |
| XLogP | 0.84 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.45 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|