C21H27N4O3S+ — CID 9150931
4-oxo-N'-[3-(4-phenylpiperazin-1-ium-1-yl)propanoyl]-4-thiophen-2-ylbutanehydrazide (PubChem CID 9150931) has the molecular formula C21H27N4O3S+ and a molecular weight of 415.54 g/mol. Its IUPAC name is 4-oxo-N'-[3-(4-phenylpiperazin-1-ium-1-yl)propanoyl]-4-thiophen-2-ylbutanehydrazide.
| Compound Name | 4-oxo-N'-[3-(4-phenylpiperazin-1-ium-1-yl)propanoyl]-4-thiophen-2-ylbutanehydrazide |
|---|---|
| PubChem CID | 9150931 |
| Molecular Formula | C21H27N4O3S+ |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | 4-oxo-N'-[3-(4-phenylpiperazin-1-ium-1-yl)propanoyl]-4-thiophen-2-ylbutanehydrazide |
| SMILES | O=C(CCC(=O)c1cccs1)NNC(=O)CC[NH+]1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C21H26N4O3S/c26-18(19-7-4-16-29-19)8-9-20(27)22-23-21(28)10-11-24-12-14-25(15-13-24)17-5-2-1-3-6-17/h1-7,16H,8-15H2,(H,22,27)(H,23,28)/p+1 |
| InChIKey | KIWLPOYKFKEJDQ-UHFFFAOYSA-O |
| XLogP | 0.65 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|