C18H22ClN4O2S+ — CID 9150982
5-chloro-N'-[3-(4-phenylpiperazin-1-ium-1-yl)propanoyl]thiophene-2-carbohydrazide (PubChem CID 9150982) has the molecular formula C18H22ClN4O2S+ and a molecular weight of 393.92 g/mol. Its IUPAC name is 5-chloro-N'-[3-(4-phenylpiperazin-1-ium-1-yl)propanoyl]thiophene-2-carbohydrazide.
| Compound Name | 5-chloro-N'-[3-(4-phenylpiperazin-1-ium-1-yl)propanoyl]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 9150982 |
| Molecular Formula | C18H22ClN4O2S+ |
| Molecular Weight | 393.92 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | 5-chloro-N'-[3-(4-phenylpiperazin-1-ium-1-yl)propanoyl]thiophene-2-carbohydrazide |
| SMILES | O=C(CC[NH+]1CCN(c2ccccc2)CC1)NNC(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C18H21ClN4O2S/c19-16-7-6-15(26-16)18(25)21-20-17(24)8-9-22-10-12-23(13-11-22)14-4-2-1-3-5-14/h1-7H,8-13H2,(H,20,24)(H,21,25)/p+1 |
| InChIKey | JYZZVQNRWWPAAW-UHFFFAOYSA-O |
| XLogP | 0.96 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.92 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|