C18H22ClN3OS — CID 38449040
5-chloro-N-[3-(4-phenylpiperazin-1-yl)propyl]thiophene-2-carboxamide (PubChem CID 38449040) has the molecular formula C18H22ClN3OS and a molecular weight of 363.91 g/mol. Its IUPAC name is 5-chloro-N-[3-(4-phenylpiperazin-1-yl)propyl]thiophene-2-carboxamide.
| Compound Name | 5-chloro-N-[3-(4-phenylpiperazin-1-yl)propyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 38449040 |
| Molecular Formula | C18H22ClN3OS |
| Molecular Weight | 363.91 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 5-chloro-N-[3-(4-phenylpiperazin-1-yl)propyl]thiophene-2-carboxamide |
| SMILES | O=C(NCCCN1CCN(c2ccccc2)CC1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C18H22ClN3OS/c19-17-8-7-16(24-17)18(23)20-9-4-10-21-11-13-22(14-12-21)15-5-2-1-3-6-15/h1-3,5-8H,4,9-14H2,(H,20,23) |
| InChIKey | KVHUVAUJTMNVLD-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.91 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|