C27H31ClN4OS — CID 20940525
N-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-5-(3,4-dihydro-2H-quinolin-1-yl)thiophene-2-carboxamide (PubChem CID 20940525) has the molecular formula C27H31ClN4OS and a molecular weight of 495.09 g/mol. Its IUPAC name is N-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-5-(3,4-dihydro-2H-quinolin-1-yl)thiophene-2-carboxamide.
| Compound Name | N-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-5-(3,4-dihydro-2H-quinolin-1-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 20940525 |
| Molecular Formula | C27H31ClN4OS |
| Molecular Weight | 495.09 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | N-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-5-(3,4-dihydro-2H-quinolin-1-yl)thiophene-2-carboxamide |
| SMILES | O=C(NCCCN1CCN(c2cccc(Cl)c2)CC1)c1ccc(N2CCCc3ccccc32)s1 |
| InChI | InChI=1S/C27H31ClN4OS/c28-22-8-3-9-23(20-22)31-18-16-30(17-19-31)14-5-13-29-27(33)25-11-12-26(34-25)32-15-4-7-21-6-1-2-10-24(21)32/h1-3,6,8-12,20H,4-5,7,13-19H2,(H,29,33) |
| InChIKey | BXWPDRDJHKEMMU-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.09 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|