C21H24ClF3N4O — CID 15989718
1-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-3-[2-(trifluoromethyl)phenyl]urea (PubChem CID 15989718) has the molecular formula C21H24ClF3N4O and a molecular weight of 440.90 g/mol. Its IUPAC name is 1-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-3-[2-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-3-[2-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 15989718 |
| Molecular Formula | C21H24ClF3N4O |
| Molecular Weight | 440.90 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | 1-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-3-[2-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(NCCCN1CCN(c2cccc(Cl)c2)CC1)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C21H24ClF3N4O/c22-16-5-3-6-17(15-16)29-13-11-28(12-14-29)10-4-9-26-20(30)27-19-8-2-1-7-18(19)21(23,24)25/h1-3,5-8,15H,4,9-14H2,(H2,26,27,30) |
| InChIKey | NZPNKTFXZCTOQZ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.90 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|