C20H19F6N3O — CID 22199190
N-[2-(trifluoromethyl)phenyl]-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]acetamide (PubChem CID 22199190) has the molecular formula C20H19F6N3O and a molecular weight of 431.38 g/mol. Its IUPAC name is N-[2-(trifluoromethyl)phenyl]-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]acetamide.
| Compound Name | N-[2-(trifluoromethyl)phenyl]-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 22199190 |
| Molecular Formula | C20H19F6N3O |
| Molecular Weight | 431.38 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | N-[2-(trifluoromethyl)phenyl]-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]acetamide |
| SMILES | O=C(CN1CCN(c2cccc(C(F)(F)F)c2)CC1)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C20H19F6N3O/c21-19(22,23)14-4-3-5-15(12-14)29-10-8-28(9-11-29)13-18(30)27-17-7-2-1-6-16(17)20(24,25)26/h1-7,12H,8-11,13H2,(H,27,30) |
| InChIKey | HKRIFKGREKHTLV-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.38 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |