C19H19F4N3O — CID 6466887
N-(2-fluorophenyl)-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]acetamide (PubChem CID 6466887) has the molecular formula C19H19F4N3O and a molecular weight of 381.37 g/mol. Its IUPAC name is N-(2-fluorophenyl)-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]acetamide.
| Compound Name | N-(2-fluorophenyl)-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 6466887 |
| Molecular Formula | C19H19F4N3O |
| Molecular Weight | 381.37 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | N-(2-fluorophenyl)-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]acetamide |
| SMILES | O=C(CN1CCN(c2cccc(C(F)(F)F)c2)CC1)Nc1ccccc1F |
| InChI | InChI=1S/C19H19F4N3O/c20-16-6-1-2-7-17(16)24-18(27)13-25-8-10-26(11-9-25)15-5-3-4-14(12-15)19(21,22)23/h1-7,12H,8-11,13H2,(H,24,27) |
| InChIKey | CKPVUQFYOYCNCT-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.37 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |