C19H17Cl3F3N3O — CID 22199205
N-(2,4,5-trichlorophenyl)-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]acetamide (PubChem CID 22199205) has the molecular formula C19H17Cl3F3N3O and a molecular weight of 466.72 g/mol. Its IUPAC name is N-(2,4,5-trichlorophenyl)-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]acetamide.
| Compound Name | N-(2,4,5-trichlorophenyl)-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 22199205 |
| Molecular Formula | C19H17Cl3F3N3O |
| Molecular Weight | 466.72 g/mol |
| Exact Mass | 465.04 |
| IUPAC Name | N-(2,4,5-trichlorophenyl)-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]acetamide |
| SMILES | O=C(CN1CCN(c2cccc(C(F)(F)F)c2)CC1)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C19H17Cl3F3N3O/c20-14-9-16(22)17(10-15(14)21)26-18(29)11-27-4-6-28(7-5-27)13-3-1-2-12(8-13)19(23,24)25/h1-3,8-10H,4-7,11H2,(H,26,29) |
| InChIKey | CTMQOYVWARWOAM-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.72 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|