C19H19ClF3N3O2 — CID 8690692
N-[2-chloro-5-(trifluoromethyl)phenyl]-2-[4-(4-hydroxyphenyl)piperazin-1-yl]acetamide (PubChem CID 8690692) has the molecular formula C19H19ClF3N3O2 and a molecular weight of 413.83 g/mol. Its IUPAC name is N-[2-chloro-5-(trifluoromethyl)phenyl]-2-[4-(4-hydroxyphenyl)piperazin-1-yl]acetamide.
| Compound Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-2-[4-(4-hydroxyphenyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 8690692 |
| Molecular Formula | C19H19ClF3N3O2 |
| Molecular Weight | 413.83 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-2-[4-(4-hydroxyphenyl)piperazin-1-yl]acetamide |
| SMILES | O=C(CN1CCN(c2ccc(O)cc2)CC1)Nc1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C19H19ClF3N3O2/c20-16-6-1-13(19(21,22)23)11-17(16)24-18(28)12-25-7-9-26(10-8-25)14-2-4-15(27)5-3-14/h1-6,11,27H,7-10,12H2,(H,24,28) |
| InChIKey | WUASPRUFAGQIEB-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.83 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |