C18H24F3N3O — CID 6466202
N-cyclopentyl-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]acetamide (PubChem CID 6466202) has the molecular formula C18H24F3N3O and a molecular weight of 355.40 g/mol. Its IUPAC name is N-cyclopentyl-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]acetamide.
| Compound Name | N-cyclopentyl-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 6466202 |
| Molecular Formula | C18H24F3N3O |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | N-cyclopentyl-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]acetamide |
| SMILES | O=C(CN1CCN(c2cccc(C(F)(F)F)c2)CC1)NC1CCCC1 |
| InChI | InChI=1S/C18H24F3N3O/c19-18(20,21)14-4-3-7-16(12-14)24-10-8-23(9-11-24)13-17(25)22-15-5-1-2-6-15/h3-4,7,12,15H,1-2,5-6,8-11,13H2,(H,22,25) |
| InChIKey | NFBGWDLYYRMGHH-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |