C19H29N3O2 — CID 6468252
N-cyclohexyl-2-[4-(3-methoxyphenyl)piperazin-1-yl]acetamide (PubChem CID 6468252) has the molecular formula C19H29N3O2 and a molecular weight of 331.46 g/mol. Its IUPAC name is N-cyclohexyl-2-[4-(3-methoxyphenyl)piperazin-1-yl]acetamide.
| Compound Name | N-cyclohexyl-2-[4-(3-methoxyphenyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 6468252 |
| Molecular Formula | C19H29N3O2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | N-cyclohexyl-2-[4-(3-methoxyphenyl)piperazin-1-yl]acetamide |
| SMILES | COc1cccc(N2CCN(CC(=O)NC3CCCCC3)CC2)c1 |
| InChI | InChI=1S/C19H29N3O2/c1-24-18-9-5-8-17(14-18)22-12-10-21(11-13-22)15-19(23)20-16-6-3-2-4-7-16/h5,8-9,14,16H,2-4,6-7,10-13,15H2,1H3,(H,20,23) |
| InChIKey | PGSSFDJWUIDQQT-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |