C18H24F3N3S — CID 1429129
N-cyclohexyl-4-[3-(trifluoromethyl)phenyl]piperazine-1-carbothioamide (PubChem CID 1429129) has the molecular formula C18H24F3N3S and a molecular weight of 371.47 g/mol. Its IUPAC name is N-cyclohexyl-4-[3-(trifluoromethyl)phenyl]piperazine-1-carbothioamide.
| Compound Name | N-cyclohexyl-4-[3-(trifluoromethyl)phenyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 1429129 |
| Molecular Formula | C18H24F3N3S |
| Molecular Weight | 371.47 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | N-cyclohexyl-4-[3-(trifluoromethyl)phenyl]piperazine-1-carbothioamide |
| SMILES | FC(F)(F)c1cccc(N2CCN(C(=S)NC3CCCCC3)CC2)c1 |
| InChI | InChI=1S/C18H24F3N3S/c19-18(20,21)14-5-4-8-16(13-14)23-9-11-24(12-10-23)17(25)22-15-6-2-1-3-7-15/h4-5,8,13,15H,1-3,6-7,9-12H2,(H,22,25) |
| InChIKey | CXYWYPGHWJZAQV-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.47 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|