C20H18F3N5S — CID 53257102
N-quinazolin-4-yl-4-[3-(trifluoromethyl)phenyl]piperazine-1-carbothioamide (PubChem CID 53257102) has the molecular formula C20H18F3N5S and a molecular weight of 417.46 g/mol. Its IUPAC name is N-quinazolin-4-yl-4-[3-(trifluoromethyl)phenyl]piperazine-1-carbothioamide.
| Compound Name | N-quinazolin-4-yl-4-[3-(trifluoromethyl)phenyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 53257102 |
| Molecular Formula | C20H18F3N5S |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | N-quinazolin-4-yl-4-[3-(trifluoromethyl)phenyl]piperazine-1-carbothioamide |
| SMILES | FC(F)(F)c1cccc(N2CCN(C(=S)Nc3ncnc4ccccc34)CC2)c1 |
| InChI | InChI=1S/C20H18F3N5S/c21-20(22,23)14-4-3-5-15(12-14)27-8-10-28(11-9-27)19(29)26-18-16-6-1-2-7-17(16)24-13-25-18/h1-7,12-13H,8-11H2,(H,24,25,26,29) |
| InChIKey | WDLKLAAQZCDKEL-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|