C19H19ClF3N3S — CID 19654969
N-(3-chloro-2-methylphenyl)-4-[3-(trifluoromethyl)phenyl]piperazine-1-carbothioamide (PubChem CID 19654969) has the molecular formula C19H19ClF3N3S and a molecular weight of 413.90 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-4-[3-(trifluoromethyl)phenyl]piperazine-1-carbothioamide.
| Compound Name | N-(3-chloro-2-methylphenyl)-4-[3-(trifluoromethyl)phenyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 19654969 |
| Molecular Formula | C19H19ClF3N3S |
| Molecular Weight | 413.90 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-4-[3-(trifluoromethyl)phenyl]piperazine-1-carbothioamide |
| SMILES | Cc1c(Cl)cccc1NC(=S)N1CCN(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C19H19ClF3N3S/c1-13-16(20)6-3-7-17(13)24-18(27)26-10-8-25(9-11-26)15-5-2-4-14(12-15)19(21,22)23/h2-7,12H,8-11H2,1H3,(H,24,27) |
| InChIKey | OVAXXBWLEWVFAM-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.90 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|