C22H19ClF3N3O2S2 — CID 19654982
methyl 3-chloro-6-[[4-[3-(trifluoromethyl)phenyl]piperazine-1-carbothioyl]amino]-1-benzothiophene-2-carboxylate (PubChem CID 19654982) has the molecular formula C22H19ClF3N3O2S2 and a molecular weight of 513.99 g/mol. Its IUPAC name is methyl 3-chloro-6-[[4-[3-(trifluoromethyl)phenyl]piperazine-1-carbothioyl]amino]-1-benzothiophene-2-carboxylate.
| Compound Name | methyl 3-chloro-6-[[4-[3-(trifluoromethyl)phenyl]piperazine-1-carbothioyl]amino]-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 19654982 |
| Molecular Formula | C22H19ClF3N3O2S2 |
| Molecular Weight | 513.99 g/mol |
| Exact Mass | 513.06 |
| IUPAC Name | methyl 3-chloro-6-[[4-[3-(trifluoromethyl)phenyl]piperazine-1-carbothioyl]amino]-1-benzothiophene-2-carboxylate |
| SMILES | COC(=O)c1sc2cc(NC(=S)N3CCN(c4cccc(C(F)(F)F)c4)CC3)ccc2c1Cl |
| InChI | InChI=1S/C22H19ClF3N3O2S2/c1-31-20(30)19-18(23)16-6-5-14(12-17(16)33-19)27-21(32)29-9-7-28(8-10-29)15-4-2-3-13(11-15)22(24,25)26/h2-6,11-12H,7-10H2,1H3,(H,27,32) |
| InChIKey | ORUYUOLQQIVEIL-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.99 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|